SB 215505
SB215505 is a potent 5-HT2B/2C receptor antagonist (pKi values are 8.3, 7.66 and 6.77 for 5-HT2B, 5-HT2C and 5-HT2A respectively). It Increases wakefulness and motor activity in rats.
| Trivial name | / |
| Catalog Number | CSN23095 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C19H16ClN3O |
| CAS# | 162100-15-4 |
| Purity | ≥98% |
| SMILES | O=C(N1CCC2=C1C=C(Cl)C(C)=C2)NC3=C4C=CC=NC4=CC=C3 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/sb-215505.html |