Rofecoxib
Rofecoxib binds to and inhibits the enzyme cyclooxygenase-2 (COX-2), resulting in an inhibition of the conversion of arachidonic acid to prostaglandins. Rofecoxib is a synthetic, nonsteroidal derivative of phenyl-furanone with anti-inflammatory, antipyretic and analgesic properties and potential antineoplastic properties. COX-related metabolic pathways may represent key regulators of cell proliferation and neo-angiogenesis. Some epithelial tumor cell types overexpress pro-angiogenic COX-2.
| Catalog Number | T1185 |
| Alternative Name(s) | MK 966 , MK-0966 |
| Research Area | Immunology/Inflammation|||Neuroscience |
| Molecular Formula | C17H14O4S |
| CAS# | 162011-90-7 |
| Purity | 99.94% |
| SMILES | CS(=O)(=O)c1ccc(cc1)C1=C(C(=O)OC1)c1ccccc1 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Rofecoxib |
| Additional Information | https://www.targetmol.com/datasheet/T1185 |
