Vincamine
Vincamine is a nootropic monoterpenoid indole alkaloid found in the leaves of Vinca minor (lesser periwinkle), which is used as a memory enhancing prescription medicine for the treatment of primary degenerative and vascular dementia.
| Trivial name | Minorin |
| Catalog Number | CSN12200 |
| Alternative Name(s) | Minorin |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C21H26N2O3 |
| CAS# | 1617-90-9 |
| Purity | ≥98% |
| SMILES | O=C([C@]1(O)N2C3=C(C4=C2C=CC=C4)CCN5[C@@]3([H])[C@](CCC5)(CC)C1)OC |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/vincamine.html |
