ZEN-2759 | MedChemExpress (MCE)
ZEN-2759 is a potent BET (Bromodomain and Extra-Terminal Domain) inhibitor, with IC50 values of 0.23, 0.08 and 0.28 μM for BRD4(BD1), BRD4(BD2), and BRD4(BD1BD2), respectively[1].
| Trivial name | ZEN-2759 |
| Catalog Number | HY-129201 |
| Research Area | Cancer |
| CAS# | 1616400-50-0 |
| Purity | 99.45% |
| SMILES | O=C1C=CC(C2=C(ON=C2C)C)=CN1CC3=CC=CC=C3 |
| PubChem Chemical Structure ID | 76683643 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/zen-2759.html |