Monomethyl Fumarate D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-20007 |
| Alternative Name(s) | (2E)-4-(²H3)methoxy-4-oxo(²H2)but-2-enoc cid |
| Research Area | Labeled Monomethyl fumarate, intended for use as an internal standard for the quantification of Monomethyl fumarate by GC- or LC-mass spectrometry. |
| Molecular Formula | C5HD5O4 |
| CAS# | 1616345-45-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OC([2H])([2H])[2H])/C([2H])=C(C(O)=O)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO20007.html |
| Additional Information | NULL |