ZK200775
ZK200775 is a highly selective AMPA/kainate antagonist with little activity against NMDA with Ki values of 3.2 nM, 100 nM, and 8.5 μM against quisqualate, kainate, and NMDA, respectively.
| Trivial name | Fanapanel; MPQX |
| Catalog Number | CSN17953 |
| Alternative Name(s) | Fanapanel; MPQX |
| Research Area | Neurological Disease |
| Molecular Formula | C14H15F3N3O6P |
| CAS# | 161605-73-8 |
| Purity | ≥98% |
| SMILES | O=C(N1CP(O)(O)=O)C(NC(C1=C2)=CC(C(F)(F)F)=C2N3CCOCC3)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/zk200775.html |