Lucifer yellow ethylenediamine | MedChemExpress (MCE)
Lucifer yellow ethylenediamine (LYen; PAsp- LY) is a polar tracer that can be coupled with aldehydes and ketones to form Schiff bases, which can be reduced to stable amine derivatives by sodium borohydride (NaBH4) or sodium cyanide borohydride (NaCNH3).
| Trivial name | Lucifer yellow ethylenediamine |
| Catalog Number | HY-D1757 |
| Alternative Name(s) | LYen; PAsp- LY |
| Research Area | Others |
| CAS# | 161578-11-6 |
| Purity | ≥98.00% |
| SMILES | O=C1C2=CC(S(=O)(O[K])=O)=CC3=C(C(S(=O)(O[K])=O)=CC(C(N1CCN)=O)=C23)N |
| PubChem Chemical Structure ID | 168679807 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lucifer-yellow-ethylenediamine.html |