(−)-L-threo-PDMP hydrochloride | MedChemExpress (MCE)
(−)-L-threo-PDMP hydrochloride is the hydrochloride form of (−)-L-threo-PDMP. L-threo-PDMP is a glucosylceramide synthase (GCS) inhibitor. L-threo-PDMP stimulates the proliferation of cultured aortic smooth muscle cells, and that increases the level of LacCer in B16 melanoma cells[1][2].
| Trivial name | (−)-L-threo-PDMP hydrochloride |
| Catalog Number | HY-116392A |
| Research Area | Cancer |
| CAS# | 161491-04-9 |
| Purity | ≥98.0% |
| SMILES | CCCCCCCCCC(N[C@@H](CN1CCOCC1)[C@H](C2=CC=CC=C2)O)=O.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/l-threo-pdmp-hydrochloride.html |