LPA receptor antagonist-1 | MedChemExpress (MCE)
LPA receptor antagonist-1 (example 52) is an antagonist of lysophosphatidic acid (LPA) receptor. LPA receptor antagonist-1 can be used for kinds of studies[1].
| Trivial name | LPA receptor antagonist-1 |
| Catalog Number | HY-160173 |
| Research Area | Others |
| CAS# | 1614824-42-8 |
| Purity | ≥98.00% |
| SMILES | OC(C1(C2=CC=C(C3=C(C=C(C4=C(C=C(S4)Cl)NC(O[C@@H](C5=CC=CC=C5)C)=O)C=C3)OC)C=C2)CC1)=O |
| PubChem Chemical Structure ID | 76683482 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lpa-receptor-antagonist-1.html |