Enitociclib (BAY 1251152)
Enitociclib (BAY 1251152) is a potent PTEFb/CDK9 inhibitor with an IC50 value of 3 nM for CDK9 and an at least 50-fold selectivity against other CDKs in enzymatic assays. BAY1251152 binds to and blocks the phosphorylation and kinase activity of CDK9, thereby preventing PTEFb-mediated activation of RNA Pol II and leading to the inhibition of gene transcription of various anti-apoptotic proteins.
| Trivial name | (+)-BAY-1251152 |
| Catalog Number | S8730 |
| Molecular Formula | C19H18F2N4O2S |
| CAS# | 1610358-56-9 |
| SMILES | COC1=C(C=CC(=C1)F)C2=CC(=NC=C2F)NC3=NC=CC(=C3)CS(=N)(=O)C |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/bay1251152.html |
| Additional Information | https://file.selleck.cn/downloads/struct/bay-1251152-chemical-structure-s8730.gif |