HA15
HA15 targets specifically BiP/GRP78/HSPA5. HA15 exhibits anti-cancerous activity on all melanoma cells tested, including cells isolated from patients and cells that developed resistance to BRAF inhibitors.
| Catalog Number | T6855 |
| Research Area | GPCR/G Protein|||Cytoskeletal Signaling|||Metabolism|||Endocrinology/Hormones|||Autophagy|||Others|||Apoptosis |
| Molecular Formula | C23H22N4O3S2 |
| CAS# | 1609402-14-3 |
| Purity | 98.00% |
| SMILES | CC(=O)Nc1nc(c2cccc(NS(=O)(=O)c3c4cccc(N(C)C)c4ccc3)c2)cs1 |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/HA15 |
| Additional Information | https://www.targetmol.com/datasheet/T6855 |
