MC-VC-PAB-Cyclohexanediamine-Thailanstatin A | MedChemExpress (MCE)
MC-VC-PAB-Cyclohexanediamine-Thailanstatin A is a Spliceostatin (HY-16466) analog, and a drug-linker conjugates for ADC, consisting of ADC Cytotoxin Thailanstatin A (HY-129589) and cleavable ADC linker (MC-vc-PAB). MC-VC-PAB-Cyclohexanediamine-Thailanstatin A can be used for ADC synthesis[1].
| Trivial name | MC-VC-PAB-Cyclohexanediamine-Thailanstatin A |
| Catalog Number | HY-153601 |
| Research Area | Cancer |
| CAS# | 1609108-96-4 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@@]2(C[C@H](O[C@@H]1/C=C/C(C)=C/C[C@H]3[C@H](C[C@H]([C@H](O3)C)NC(/C=C\[C@H](C)OC(C)=O)=O)C)CC(N[C@@H]4CC[C@H](CC4)NC(OCC5=CC=C(C=C5)NC([C@H](CCCNC(N)=O)NC([C@H](C(C)C)NC(CCCCCN6C(C=CC6=O)=O)=O)=O)=O)=O)=O)CO2 |
| PubChem Chemical Structure ID | 90123907 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-vc-pab-cyclohexanediamine-thailanstatin-a.html |