Elamipretide TFA | MedChemExpress (MCE)
Elamipretide TFA (MTP-131 TFA; RX-31 TFA; SS-31 TFA) is the TFA salt form of Elamipretide (HY-P0125). Elamipretide TFA is a mitochondria-targeting peptide, which ameliorates myocardial infarction, improves the renal function and protects neurons form inflammatory and oxidative stress injury[1][2].
| Trivial name | Elamipretide TFA |
| Catalog Number | HY-P0125A |
| Alternative Name(s) | MTP-131 TFA; RX-31 TFA; SS-31 TFA |
| Research Area | Neurological Disease; Inflammation/Immunology; Cardiovascular Disease |
| CAS# | 1606994-55-1 |
| Purity | ≥98.0% |
| SMILES | O=C(N)[C@H](CC1=CC=CC=C1)NC([C@H](CCCCN)NC([C@H](CC2=C(C)C=C(O)C=C2C)NC([C@@H](CCCNC(N)=N)N)=O)=O)=O.O=C(O)C(F)(F)F |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/elamipretide-tfa.html |