1-Pyrenamin | MedChemExpress (MCE)
1-Pyrenamin (1-Pyrenamine purified by sublimation) is utilized to create highly efficient and stable catalyst supports in direct methanol fuel cells through noncovalent functionalization of graphite nanosheets[1].
| Trivial name | 1-Pyrenamin |
| Catalog Number | HY-W094751 |
| Alternative Name(s) | 1-Pyrenamine (purified by sublimation) |
| Research Area | Others |
| CAS# | 1606-67-3 |
| Purity | ≥98.0% |
| SMILES | NC1=C(C2=C34)C=CC4=CC=CC3=CC=C2C=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/1-pyrenamin.html |