Mavodelpar | MedChemExpress (MCE)
Mavodelpar (REN001) is a selective PPARĪ“ agonist. Mavodelpar suppresses glomerular injury and renal fibrosis. Mavodelpar can be used for the research of primary mitochondrial myopathies (PMM) and long-chain fatty acid oxidation disorders (LC-FAOD)[1]. Mavodelpar is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
Trivial name | Mavodelpar |
Catalog Number | HY-112597A |
Alternative Name(s) | REN001; HPP593 |
Research Area | Inflammation/Immunology |
CAS# | 1604815-32-8 |
Purity | 99.89% |
SMILES | O=C(O[Na])COC1=CC=C(OC/C=C(C2=CC=C(F)C=C2)\C3=CC=C(C#CCN4CCOCC4)C=C3)C=C1C |
PubChem Chemical Structure ID | 122662515 |
Size | 50 mg |
Supplier Page | https://www.medchemexpress.com/mavodelpar.html |