Nelfinavir Mesylate
Nelfinavir Mesylate is a selective and potent HIV-1 protease inhibitor used in combination with other antiviral drugs in the treatment of HIV.
| Trivial name | AG 1343 Mesylate |
| Catalog Number | CSN11535 |
| Alternative Name(s) | AG 1343 Mesylate |
| Research Area | Infection |
| Molecular Formula | C33H49N3O7S2 |
| CAS# | 159989-65-8 |
| Purity | ≥98% |
| SMILES | O=C([C@H]1N(C[C@@H](O)[C@@H](NC(C2=CC=CC(O)=C2C)=O)CSC3=CC=CC=C3)C[C@@]4([H])CCCC[C@@]4([H])C1)NC(C)(C)C.OS(=O)(C)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/nelfinavir-mesylate.html |
