XPhos Pd G4
XPhos Pd G4 is a metal palladium catalyst, which can be prepared by the reaction of a bisphosphonate ligand and a palladium catalyst precursor compound, and is often used to catalyze various coupling reactions.
| Catalog Number | CHE1599466815 |
| Alternative Name(s) | Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) |
| Research Area | Chemicals |
| Molecular Formula | C47H64NO3PPdS |
| CAS# | 1599466-81-5 |
| SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/xphos-pd-g4-item-6489.html |