Mal-PEG2-Gly-Gly-Phe-Gly-Exatecan | MedChemExpress (MCE)
Mal-PEG2-Gly-Gly-Phe-Gly-Exatecan is a drug-linker conjugate for ADC. Mal-PEG2-Gly-Gly-Phe-Gly-Exatecan consists of Exatecan (HY-13631) and a linker. Mal-PEG2-Gly-Gly-Phe-Gly-Exatecan can be used for synthesis of ADCs and for cancer research[1].
| Trivial name | Mal-PEG2-Gly-Gly-Phe-Gly-Exatecan |
| Catalog Number | HY-153795 |
| Research Area | Cancer |
| CAS# | 1599439-54-9 |
| Purity | 99.09% |
| SMILES | O=C(C=CC1=O)N1CCC(NCCOCCOCCC(NCC(NCC(N[C@@H](CC2=CC=CC=C2)C(NCC(NCCCC(N[C@@H]3C4=C5C(C(N6C5)=CC([C@](O)(C(OC7)=O)CC)=C7C6=O)=NC8=CC(F)=C(C)C(CC3)=C84)=O)=O)=O)=O)=O)=O)=O |
| PubChem Chemical Structure ID | 118305302 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/mal-peg2-gly-gly-phe-gly-exatecan.html |