Mc-Val-Cit-PABC-PNP (GMP) | MedChemExpress (MCE)
Mc-Val-Cit-PABC-PNP GMP is a GMP grade Mc-Val-Cit-PABC-PNP (HY-20336). Mc-Val-Cit-PABC-PNP is a cathepsin cleavable ADC linker. Mc-Val-Cit-PABC-PNP can be used in the synthesis of antibody-drug conjugates (ADCs)[1].
| Trivial name | Mc-Val-Cit-PABC-PNP (GMP) |
| Catalog Number | HY-20336G |
| Research Area | Cancer |
| CAS# | 159857-81-5 |
| Purity | ≥98.00% |
| SMILES | CC(C)[C@@H](C(N[C@@H](CCCNC(N)=O)C(NC1=CC=C(COC(OC2=CC=C([N+]([O-])=O)C=C2)=O)C=C1)=O)=O)NC(CCCCCN3C(C=CC3=O)=O)=O |
| PubChem Chemical Structure ID | 57587849 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-val-cit-pabc-pnp-gmp.html |