MC-Val-Cit-PAB (GMP) | MedChemExpress (MCE)
MC-Val-Cit-PAB GMP is a GMP grade MC-Val-Cit-PAB (HY-78738). MC-Val-Cit-PAB is an intermediate in the synthesis of VcMMAE (HY-15575), which is a Drug-Linker Conjugates for ADC. Monomethyl auristatin E can be used to inhibit Microtubule/Tubulin as ADC Cytotoxin.
| Trivial name | MC-Val-Cit-PAB (GMP) |
| Catalog Number | HY-78738G |
| Research Area | Cancer |
| CAS# | 159857-80-4 |
| Purity | ≥98.00% |
| SMILES | CC(C)[C@@H](C(N[C@@H](CCCNC(N)=O)C(NC1=CC=C(CO)C=C1)=O)=O)NC(CCCCCN2C(C=CC2=O)=O)=O |
| PubChem Chemical Structure ID | 57544445 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-val-cit-pab-gmp.html |