ent-8-iso Prostaglandin F2α | MedChemExpress (MCE)
ent-8-iso Prostaglandin F2α (ent-15-F2t-IsoP) is a potent vasoconstrictor of porcine retina and cerebral microvessels with EC50 values of 30.6 and 53.5 nM, respectively[1].
| Trivial name | ent-8-iso Prostaglandin F2α |
| Catalog Number | HY-114593 |
| Alternative Name(s) | ent-15-F2t-IsoP |
| Research Area | Cardiovascular Disease |
| CAS# | 159812-83-6 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@@H]1[C@@H]([C@H](C[C@H]1O)O)/C=C/[C@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ent-8-iso-prostaglandin-f2α.html |