Z-Gly-Pro-Phe-Leu-CHO | MedChemExpress (MCE)
Z-Gly-Pro-Phe-Leu-CHO (Z-GPFL-CHO) is a tetrapeptide aldehyde that acts as a highly selective and potent proteasomal inhibitor (Ki = 1.5 µM for branched chain amino acid preferring, 2.3 µM for small neutral amino acid preferring, and 40.5 µM for chymotrypsin-like activities; IC50 = 3.1 µM for peptidyl-glutamyl peptide hydrolyzing activity)[1].
| Trivial name | Z-Gly-Pro-Phe-Leu-CHO |
| Catalog Number | HY-P10007 |
| Alternative Name(s) | Z-GPFL-CHO |
| Research Area | Cancer |
| CAS# | 159659-05-9 |
| Purity | ≥98.00% |
| SMILES | O=C([C@H](CCC1)N1C(CNC(OCC2=CC=CC=C2)=O)=O)N[C@H](C(N[C@H](C=O)CC(C)C)=O)CC3=CC=CC=C3 |
| PubChem Chemical Structure ID | 15383668 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/z-gly-pro-phe-leu-cho.html |