Daminozide
Daminozide (Aminozide, DMASA, DIMG, B 995, Alar, Kylar, B-NINE, SADH) is a plant growth regulator that selectively inhibits human KDM2/7 histone demethylases, with IC50 of 0.55 μM for PHF8 (KDM7B), 1.5 μM for KDM2A, and 2.1 μM for KIAA1718 (KDM7A). It shows over 100-fold selectivity for the KDM2/7 subfamily compared to other histone demethylase subfamilies, with significantly weaker activity against enzymes such as KDM3A with IC50 of 127 μM.
| Trivial name | Aminozide, DMASA, DIMG, B 995, Alar, Kylar, B-NINE, SADH |
| Catalog Number | S4800 |
| Molecular Formula | C16H19Cl2N3O4S |
| CAS# | 1596-84-5 |
| SMILES | C[S](=O)(=O)N1CCN(CC1)C(=O)CNC(=O)/C=C/C2=CC(=C(Cl)C=C2)Cl |
| Size | 500mg |
| Supplier Page | http://www.selleckchem.com/products/daminozide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/S4800-Daminozide-chemical-structure.png |
