Everolimus
Everolimus is an mTOR inhibitor of FKBP12 with IC50 of 1.6-2.4 nM in a cell-free assay. Everolimus induces cell apoptosis and autophagy and inhibits tumor cells proliferation.
| Trivial name | RAD001,SDZ-RAD |
| Catalog Number | S1120 |
| Molecular Formula | C28H28ClN3OS |
| CAS# | 159351-69-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CNC1CCC(CC1)N(CC2=CC(=CC=C2)C3=CC=NC=C3)C(=O)C4=C(Cl)C5=CC=CC=C5S4 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/Everolimus(RAD001).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Everolimus-RAD001-chemical-structure-S1120.gif |
