Rimonabant Hydrochloride
API Standard
| Catalog Number | CS-O-30748 |
| Research Area | Rimonabant is an anorectic anti-obesity drug produced and marketed by Sanofi-Aventis. It is an inverse agonist for the cannabinoid receptor CB1. Its main avenue of effect is reduction in appetite. |
| Molecular Formula | C22H2Cl4N4O |
| CAS# | 158681-13-1 |
| Purity | >98% |
| SMILES | CC1=C(C2=CC=C(Cl)C=C2)N(C(C=CC(Cl)=C3)=C3Cl)N=C1C(NN4CCCCC4)=O.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30748.html |