Cromolyn Sodium
Antiallergics, with good preventive and therapeutic effects on rapid-onset allergic reactions, are used to prevent allergic asthma attacks and improve subjective symptoms.
| Catalog Number | API15826376 |
| Alternative Name(s) | Sodium cromoglycate Disodium cromoglycate sodium cromoglicate |
| Research Area | Antiasthmatic APIs |
| Molecular Formula | C23H14Na2O11 |
| CAS# | 15826-37-6 |
| SMILES | C1=CC2=C(C(=C1)OCC(COC3=CC=CC4=C3C(=O)C=C(O4)C(=O)[O-])O)C(=O)C=C(O2)C(=O)[O-].[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/cromolyn-sodium-item-11547.html |