157322-47-9 | Eribulin Fragment B Alcohol – ChemExpress
Chemexpress supplying Auristatin E CAS：160800-57-7products and technical services. kilogram GMP conditions plants, harmaceutical intermediate and APIs accompanied,Focus on small molecule drug discovery.
| Trivial name | Eribulin Fragment B Alcohol |
| Catalog Number | HY-41227 |
| Research Area | ADC |
| Molecular Formula | C21H35IO4 |
| CAS# | 157322-47-9 |
| SMILES | C=C1C[C@H](CCCOC(C(C)(C)C)=O)O[C@H]1CC[C@@H](O)C[C@H](C(I)=C)C |
| Size | 10kg |
| Supplier Page | https://www.chemexpress.com/product/HY-15582 |