Travoprost
Travoprost is a synthetic prostaglandin F2α analog as a potent and selective FP prostaglandin receptor agonist, used for controlling the progression of glaucoma or ocular hypertension, by reducing intraocular pressure.
| Trivial name | Travoprostum |
| Catalog Number | CSN12127 |
| Alternative Name(s) | Travoprostum |
| Research Area | / |
| Molecular Formula | C26H35F3O6 |
| CAS# | 157283-68-6 |
| Purity | ≥98% |
| SMILES | O=C(OC(C)C)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COC2=CC=CC(C(F)(F)F)=C2)[C@H](O)C[C@@H]1O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/travoprost.html |
