(+)-Cloprostenol isopropyl ester
A more lipid soluble form of (+)-cloprostenol
| Catalog Number | 10010016 |
| Alternative Name(s) | (+)-16-m-chlorophenoxy tetranor Prostaglandin F2α isopropyl ester|(+)-5-cis Cloprostenol isopropyl ester |
| Research Area | Product Type|Lipids|Prostaglandins||Product Type|Small Molecule Modulators|Receptor Pharmacology|Agonists||Research Area|Endocrinology & Metabolism|Reproductive Biology||Research Area|Lipid Biochemistry|Cyclooxygenase Pathway |
| Molecular Formula | C25H35ClO6 |
| CAS# | 157283-66-4 |
| Purity | ≥98% |
| Inchi | InChI=1S/C25H35ClO6/c1-17(2)32-25(30)11-6-4-3-5-10-21-22(24(29)15-23(21)28)13-12-19(27)16-31-20-9-7-8-18(26)14-20/h3,5,7-9,12-14,17,19,21-24,27-29H,4,6,10-11,15-16H2,1-2H3/b5-3-,13-12+/t19-,21-,22-,23+,24-/m1/s1 |
| Inchi Key | OCNSAYQJDKJOLH-AHTXBMBWSA-N |
| SMILES | CC(C)OC(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COC2=CC=CC(Cl)=C2)[C@H](O)C[C@@H]1O)=O |
| Size | 5 mg |
| Supplier Page | https://www.caymanchem.com/product/10010016 |
