Bosentan Hydrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00970 |
| Alternative Name(s) | Bosetan;bosentan hydrate;Bosentan monHydroxyydrate;4-tert-butyl-N-[6-(2-hydroxyethoxy)-5-(2-Methoxyphenoxy)-2-(pyriMidin-2-yl)pyriMidin-4-yl]benzene-1-sulfonaMide;4-(1,1-Dimethylethyl)-N-(6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy) |
| Research Area | Bosentan is a sulfonamide-derived, competitive and specific endothelin receptor antagonist with a slightly higher affinity for the endothelin A receptor than endothelin B receptor. Bosentan blocks the action of endothelin 1, an extremely potent endogenous |
| Molecular Formula | C27H31N5O7S |
| CAS# | 157212-55-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=C(C=CC=C1)OC(C(N[S](=O)(C2=CC=C(C(C)(C)C)C=C2)=O)=NC(C3=NC=CC=N3)=N4)=C4OCCO.O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00970.html |
| Additional Information | NULL |