Bosentan Hydrate
endothelin receptor antagonist GPCR/G protein|Endothelin Receptor
| Catalog Number | B1521-50 |
| Research Area | GPCR/G protein|Endothelin Receptor |
| Molecular Formula | C27H31N5O7S |
| CAS# | 157212-55-0 |
| Purity | 99.25% |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2=C(C(=NC(=N2)C3=NC=CC=N3)OCCO)OC4=CC=CC=C4OC.O |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1521 |
