Methyl 4-formylbenzoate | MedChemExpress (MCE)
Methyl 4-formylbenzoate (4-Carbomethoxybenzaldehyde; 4-Carboxybenzaldehyde methyl ester; Terephthalaldehydic acid methyl ester) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
| Trivial name | Methyl 4-formylbenzoate |
| Catalog Number | HY-78000 |
| Alternative Name(s) | 4-Carbomethoxybenzaldehyde; 4-Carboxybenzaldehyde methyl ester; Terephthalaldehydic acid methyl ester; Methyl 4-formylbenzoate |
| Research Area | Others |
| CAS# | 1571-08-0 |
| Purity | ≥98.0% |
| SMILES | O=C(OC)C1=CC=C(C([H])=O)C=C1 |
| Size | 5 g |
| Supplier Page | https://www.medchemexpress.com/methyl-4-formylbenzoate.html |