(-)-OSU6162 hydrochloride | MedChemExpress (MCE)
(-)-OSU6162 (PNU96391) hydrochloride is a dopamine stabilizer. (-)-OSU6162 hydrochloride acts as partial agonist at 5-HT2A and is a dopamine D2 antagonist. (-)-OSU6162 hydrochloride can be used for the research of aggression and irritability[1][2].
| Trivial name | (-)-OSU6162 hydrochloride |
| Catalog Number | HY-103403 |
| Alternative Name(s) | PNU96391 hydrochloride |
| Research Area | Neurological Disease |
| CAS# | 156907-84-5 |
| Purity | ≥98.00% |
| SMILES | CCCN1C[C@H](C2=CC=CC(S(=O)(C)=O)=C2)CCC1.[H]Cl |
| PubChem Chemical Structure ID | 9836644 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/minus-osu6162-hydrochloride.html |