Ibuprofen
Ibuprofen is an anti-inflammatory inhibitor targeting COX-1 and COX-2 with IC50 of 13 μM and 370 μM, respectively, and is used for pain relief, fever reduction and for reducing swelling.
| Trivial name | (±)-Ibuprofen |
| Catalog Number | CSN11183 |
| Alternative Name(s) | (±)-Ibuprofen |
| Research Area | Infection |
| Molecular Formula | C13H18O2 |
| CAS# | 15687-27-1 |
| Purity | ≥99% |
| SMILES | C1=CC(=CC=C1C(C(=O)O)C)CC(C)C |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/ibuprofen.html |