NS1652
NS1652 is a reversible chloride channel blocker, potently inhibits the chloride conductance (IC50 = 1.6 μM) in human and mouse red blood cells, but only weakly volume activated anion conductance (VRAC) (IC50 = 125 μM) in HEK293 cells.
| Trivial name | N/A |
| Catalog Number | S2955 |
| Molecular Formula | C15H11F3N2O3 |
| CAS# | 1566-81-0 |
| SMILES | OC(=O)C1=CC=CC=C1NC(=O)NC2=CC=CC(=C2)C(F)(F)F |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/ns1652.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s2955-ns1652-chemical-structure.gif |