Myricetin 3-O-Galactoside
Myricetin 3-O-galactoside is a natural product isolated and purified from the root bark of Myrica cerifera L. which modulates the expression patterns of cellular genes involved in oxidative stress.
| Trivial name | / |
| Catalog Number | CSN13244 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C21H20O13 |
| CAS# | 15648-86-9 |
| Purity | ≥98% |
| SMILES | O=C1C(O[C@H]2[C@@H]([C@H]([C@H]([C@@H](CO)O2)O)O)O)=C(C3=CC(O)=C(O)C(O)=C3)OC4=CC(O)=CC(O)=C14 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/myricetin-3-o-galactoside.html |