(+)-Erinacin A | MedChemExpress (MCE)
(+)-Erinacin A is an anticancer compound that can be isolated from the mushroom Hericium erinaceum. (+)-Erinacin A has the capacity to trigger cancer cell death dependent on the production of reactive oxygen species (ROS). (+)-Erinacin A has anticancer and neuroprotective activity[1].
| Trivial name | (+)-Erinacin A |
| Catalog Number | HY-111954 |
| Alternative Name(s) | Erinacine A |
| Research Area | Neurological Disease; Cancer |
| CAS# | 156101-08-5 |
| Purity | 99.97% |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@@H]2[C@@](CC[C@]3(C)C4=C(C(C)C)CC3)(C)C4=CC=C(C=O)C2)OC1 |
| PubChem Chemical Structure ID | 10410568 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/plus-erinacin-a.html |