(+)-Bw373u86
| Catalog Number | BD00944585 |
| Molecular Formula | C27H37N3O2 |
| CAS# | 155836-50-3 |
| Purity | 97% |
| SMILES | O=C(C1=CC=C(C=C1)[C@H](C2=CC=CC(O)=C2)N3[C@H](CN([C@@H](C3)C)CC=C)C)N(CC)CC |
| Size | 1g |
| Supplier Page | http://www.bldpharm.com/products/155836-50-3.html |
