Ibrutinib D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13635 |
| Alternative Name(s) | 1-[(3R)-3-[4-Amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl]-1-piperidinyl]-2-propen-1-one-d5; PCI 32765-d5; PCI 32765-00-d5; CRA 032765-d5; (R)-1-(3-(4-Amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)piperidin-1-yl)prop-2-en-1-one-d5 |
| Research Area | Labeled Ibrutinib, intended for use as an internal standard for the quantification of Ibrutinib by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H19D5N6O2 |
| CAS# | 1553977-17-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC1=C(C(C2=CC=C(OC(C([2H])=C3[2H])=C(C([2H])=C3[2H])[2H])C=C2)=NN4[C@H](CCC5)CN5C(C=C)=O)C4=NC=N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13635.html |
| Additional Information | NULL |