Rosiglitazone maleate 10mM * 1mL in DMSO
Rosiglitazone maleate, an antidiabetic drug, works as an insulin sensitizer, by binding to the PPAR receptors in fat cells and making the cells more responsive to insulin.
| Trivial name | Rosiglitazone maleate 10mM * 1mL in DMSO |
| Catalog Number | A10809-10mM-D |
| Alternative Name(s) | 5-{p-[2-(Methyl-2-pyridylamino)ethoxy]benzyl}-2,4-thiazolidinedione maleate |
| Molecular Formula | C22H23N3O7S |
| CAS# | 155141-29-0 |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3.C(=CC(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rosiglitazone-maleate.html |