Methscopolamine bromide 10mM * 1mL in DMSO
Methscopolamine bromide is a competitive antimuscarinic agent that blocks the binding of acetylcholine at muscarinic acetylcholine receptors (mAChR M).
| Trivial name | Methscopolamine bromide 10mM * 1mL in DMSO |
| Catalog Number | A10579-10mM-D |
| Alternative Name(s) | (-)-Scopolamine methyl bromide |
| Molecular Formula | C18H24NO4.Br |
| CAS# | 155-41-9 |
| SMILES | C[N+]1([C@H]2CC(C[C@H]1C3C2O3)OC(=O)[C@H](CO)C4=CC=CC=C4)C.[Br-] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/methscopolamine-bromide.html |
