Capecitabine 5g
Capecitabine is a prodrug, that is enzymatically converted to 5-fluorouracil in the tumor, where it inhibits DNA synthesis and slows growth of tumor tissue. The activation of capecitabine follows a pathway with three enzymatic steps and two intermediary metabolites, 5′-deoxy-5-fluorocytidine (5′-DFCR) and 5′-deoxy-5-fluorouridine (5′-DFUR), to form 5-fluorouracil.
Trivial name | Capecitabine 5g |
Catalog Number | A10177-5000 |
Alternative Name(s) | pentyl [1-(3,4-dihydroxy-5-methyltetrahydrofuran-2-yl)-5-fluoro-2-oxo-1H-pyrimidin-4-yl]carbamate |
Molecular Formula | C₁₅H₂₂FN₃O₆ |
CAS# | 154361-50-9 |
SMILES | CCCCCOC(=O)NC1=NC(=O)N(C=C1F)[C@H]2[C@@H]([C@@H]([C@H](O2)C)O)O |
Size | 5000mg |
Supplier Page | http://www.adooq.com/capecitabine-xeloda.html |