Abiraterone
Abiraterone is a potent CYP17 inhibitor with IC50 of 2 nM in a cell-free assay. Abiraterone (CB-7598) is an androgen biosynthesis inhibitor.
| Trivial name | CB-7598 |
| Catalog Number | S1123 |
| Molecular Formula | C27H40N8O7 |
| CAS# | 154229-19-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC(C)C1N(C)C(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(O)=O)NC(=O)CNC(=O)C(CCCNC(N)=N)NC1=O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/Abiraterone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Abiraterone-CB-7598-chemical-structure-S1123.gif |
