Abiraterone Acetate D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06372 |
| Alternative Name(s) | NULL |
| Research Area | Abiraterone Stable Isotope;Application of Labeled APIs: Labeled Abiraterone, intended for use as an internal standard for the quantification of Abiraterone by GC- or LC-mass spectrometry. |
| Molecular Formula | C26H29D4NO2 |
| CAS# | 154229-18-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1(C(C2=C([2H])N=C([2H])C([2H])=C2[2H])=CC3)[C@]3([H])[C@@](CC=C4[C@@]5(CC[C@H](OC(C)=O)C4)C)([H])[C@]5([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06372.html |
| Additional Information | NULL |