Abiraterone Acetate
Abiraterone Acetate is an acetate salt form of Abiraterone which is a steroidal cytochrome CYP17 inhibitor with IC50 of 72 nM in a cell-free assay. Abiraterone acetate is an oral androgen biosynthesis inhibitor.
| Trivial name | CB7630 Acetate |
| Catalog Number | S2246 |
| Molecular Formula | C13H13BrN2O4S |
| CAS# | 154229-18-2 |
| Inchi | InChI=1S/C11H11BrN2S.C2H2O4/c12-9-3-1-8(2-4-9)10-7-14-5-6-15-11(14)13-10;3-1(4)2(5)6/h1-4,10H,5-7H2;(H,3,4)(H,5,6)/t10-;/m1./s1 |
| Inchi Key | ZULBIBHDIQCNIS-HNCPQSOCSA-N |
| SMILES | C1CSC2=NC(CN21)C3=CC=C(C=C3)Br.C(=O)(C(=O)O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/Abiraterone-Acetate-CB7630.html |
| Additional Information | https://file.selleck.cn/downloads/struct/abiraterone-acetate-chemical-structure-s2246.gif |
