9-OAHSA | MedChemExpress (MCE)
9-OAHSA is a fatty acid ester of hydroxy fatty acids (FAHFAs). 9-OAHSA shows anti-inflammatory effects via inhibiting cytokine production and reduces IL-1β and IL-6 expression. 9-OAHSA is also a protective molecule to prevent colon carcinoma cells from apoptotic cell death[1][2][3].
| Trivial name | 9-OAHSA |
| Catalog Number | HY-131934 |
| Research Area | Inflammation/Immunology |
| CAS# | 154086-90-5 |
| Purity | ≥98.0% |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(OC(CCCCCCCC(O)=O)CCCCCCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/9-oahsa.html |