3-Deoxy-D-glycero-D-galacto-2-nonulosonic acid | MedChemExpress (MCE)
3-Deoxy-D-glycero-D-galacto-2-nonulosonic acid (KDN) is a sialic acid. 3-Deoxy-D-glycero-D-galacto-2-nonulosonic acid protects the oligo/(poly)sialyl chains from exosialidases at nonreducing terminal, and plays a role in egg activation of salmonid fish[1]. 3-Deoxy-D-glycero-D-galacto-2-nonulosonic acid is abundant in fetal cord red blood cells and malignant human ovarian cancer cells[2].
![](https://smallmolecules.com/sm/wp-content/uploads/products/medchem-express/56/5602490220501685843-14.jpg)
Trivial name | 3-Deoxy-D-glycero-D-galacto-2-nonulosonic acid |
Catalog Number | HY-145533 |
Alternative Name(s) | KDN |
Research Area | Others |
CAS# | 153666-19-4 |
Purity | ≥98.0% |
SMILES | OC[C@@H](O)[C@H]([C@]1([H])OC(O)(C[C@@H]([C@H]1O)O)C(O)=O)O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/3-deoxy-d-glycero-d-galacto-2-nonulosonic-acid.html |