Bexarotene D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15677 |
| Alternative Name(s) | 4‐[1‐(3,5,5,8,8‐pentamethyl‐5,6,7,8‐tetrahydronaphthalen-2‐yl)ethenyl](D4)benzoic acid |
| Research Area | Labeled Bexarotene, intended for use as an internal standard for the quantification of Bexarotene by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H24D4O2 |
| CAS# | 153559-49-0 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1(C2=CC(C(C3=C([2H])C([2H])=C(C(O)=O)C([2H])=C3[2H])=C)=C(C)C=C2C(C)(C)CC1)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15677.html |
| Additional Information | NULL |