Fexofenadine Hydrochloride
Fexofenadine Hydrochloride is the hydrochloride salt form of fexofenadine, a carboxylated metabolic derivative of terfenadine and second generation, long-lasting selective histamine H1 receptor antagonist, with antihistaminic activity.
| Catalog Number | API153439408 |
| Alternative Name(s) | FEXOFENADINE HCL Allegra 2-(4-(1-Hydroxy-4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)butyl)phenyl)-2-methylpropanoic acid hydrochloride |
| Research Area | Antihistamine APIs |
| Molecular Formula | C32H40ClNO4 |
| CAS# | 153439-40-8 |
| SMILES | CC(C)(C1=CC=C(C=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O)C(=O)O.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/fexofenadine-hydrochloride-item-12227.html |