SCR7 10mg
SCR7 is a specific DNA Ligase IV inhibitor. SCR7 inhibits end joining of double strand breaks in diverse cell types resulting in tumour regression by activation of p53 mediated apoptosis.
Trivial name | SCR7 10mg |
Catalog Number | A15447-10 |
Alternative Name(s) | 5,6-bis((E)-benzylideneamino)-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
Molecular Formula | C18H14N4OS |
CAS# | 1533426-72-0 |
SMILES | O=C(C(/N=C/C1=CC=CC=C1)=C(/N=C/C2=CC=CC=C2)N3)NC3=S |
Size | 10mg |
Supplier Page | http://www.adooq.com/scr7.html |